C27H38N2O3 — CID 127032160
2-hydroxy-N-[2-[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]amino]ethyl]benzamide (PubChem CID 127032160) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]amino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 127032160 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 2-hydroxy-N-[2-[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]amino]ethyl]benzamide |
| SMILES | CC/C=C\C=C\C=C\C=C/CCCCCCCC(=O)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C27H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-26(31)28-22-23-29-27(32)24-19-17-18-20-25(24)30/h3-10,17-20,30H,2,11-16,21-23H2,1H3,(H,28,31)(H,29,32)/b4-3-,6-5+,8-7+,10-9- |
| InChIKey | DUDAAQICZZHHQJ-ZSCYQOFPSA-N |
| XLogP | 5.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|