C25H40N2O3S — CID 71257077
2-hydroxy-N-[2-[(2-tetradec-6-enylsulfanylacetyl)amino]ethyl]benzamide (PubChem CID 71257077) has the molecular formula C25H40N2O3S and a molecular weight of 448.67 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[(2-tetradec-6-enylsulfanylacetyl)amino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[(2-tetradec-6-enylsulfanylacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 71257077 |
| Molecular Formula | C25H40N2O3S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-hydroxy-N-[2-[(2-tetradec-6-enylsulfanylacetyl)amino]ethyl]benzamide |
| SMILES | CCCCCCCC=CCCCCCSCC(=O)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C25H40N2O3S/c1-2-3-4-5-6-7-8-9-10-11-12-15-20-31-21-24(29)26-18-19-27-25(30)22-16-13-14-17-23(22)28/h8-9,13-14,16-17,28H,2-7,10-12,15,18-21H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | LCIDBPBVTOJXNE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|