C16H26N4O2 — CID 111075603
N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]-2-hydroxybenzamide (PubChem CID 111075603) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 111075603 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]-2-hydroxybenzamide |
| SMILES | CCCCCC/N=C(\N)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C16H26N4O2/c1-2-3-4-7-10-19-16(17)20-12-11-18-15(22)13-8-5-6-9-14(13)21/h5-6,8-9,21H,2-4,7,10-12H2,1H3,(H,18,22)(H3,17,19,20) |
| InChIKey | GFNVWFYTJOWYJJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|