C15H23F2N3 — CID 111060701
1-[2-(2,6-difluorophenyl)ethyl]-2-hexylguanidine (PubChem CID 111060701) has the molecular formula C15H23F2N3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-2-hexylguanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-hexylguanidine |
|---|---|
| PubChem CID | 111060701 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-hexylguanidine |
| SMILES | CCCCCC/N=C(\N)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C15H23F2N3/c1-2-3-4-5-10-19-15(18)20-11-9-12-13(16)7-6-8-14(12)17/h6-8H,2-5,9-11H2,1H3,(H3,18,19,20) |
| InChIKey | JROBWPXXRXPCJN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|