C14H21F2N3 — CID 111151144
1-butyl-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111151144) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-butyl-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-butyl-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111151144 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-butyl-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine |
| SMILES | CCCCN/C(=N\C)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C14H21F2N3/c1-3-4-9-18-14(17-2)19-10-8-11-12(15)6-5-7-13(11)16/h5-7H,3-4,8-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | IDGZBZFLOMMKCV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|