C15H24F2IN3 — CID 111000978
1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111000978) has the molecular formula C15H24F2IN3 and a molecular weight of 411.28 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111000978 |
| Molecular Formula | C15H24F2IN3 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c(F)cccc1F)NC(C)C(C)C.I |
| InChI | InChI=1S/C15H23F2N3.HI/c1-10(2)11(3)20-15(18-4)19-9-8-12-13(16)6-5-7-14(12)17;/h5-7,10-11H,8-9H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | LXFONXVGULYDDT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|