C16H26F2IN3 — CID 111000980
2-[2-(2,6-difluorophenyl)ethyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111000980) has the molecular formula C16H26F2IN3 and a molecular weight of 425.31 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)ethyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(2,6-difluorophenyl)ethyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111000980 |
| Molecular Formula | C16H26F2IN3 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)ethyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(F)cccc1F)NC(C)C(C)C.I |
| InChI | InChI=1S/C16H25F2N3.HI/c1-5-19-16(21-12(4)11(2)3)20-10-9-13-14(17)7-6-8-15(13)18;/h6-8,11-12H,5,9-10H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | WCDNAMWZYHZKOV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|