C16H29IN4 — CID 111001106
1-(3-anilinopropyl)-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111001106) has the molecular formula C16H29IN4 and a molecular weight of 404.34 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-(3-anilinopropyl)-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111001106 |
| Molecular Formula | C16H29IN4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(3-anilinopropyl)-2-methyl-3-(3-methylbutan-2-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNc1ccccc1)NC(C)C(C)C.I |
| InChI | InChI=1S/C16H28N4.HI/c1-13(2)14(3)20-16(17-4)19-12-8-11-18-15-9-6-5-7-10-15;/h5-7,9-10,13-14,18H,8,11-12H2,1-4H3,(H2,17,19,20);1H |
| InChIKey | GKZPEBINMOCUDG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|