C14H25IN4S — CID 111343872
1-(3-anilinopropyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111343872) has the molecular formula C14H25IN4S and a molecular weight of 408.35 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-anilinopropyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111343872 |
| Molecular Formula | C14H25IN4S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-(3-anilinopropyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNc1ccccc1)NCCSC.I |
| InChI | InChI=1S/C14H24N4S.HI/c1-15-14(18-11-12-19-2)17-10-6-9-16-13-7-4-3-5-8-13;/h3-5,7-8,16H,6,9-12H2,1-2H3,(H2,15,17,18);1H |
| InChIKey | BAPJUASWFBEJKM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|