C15H17F2N3S — CID 111941271
1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111941271) has the molecular formula C15H17F2N3S and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111941271 |
| Molecular Formula | C15H17F2N3S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCc1c(F)cccc1F)NCc1ccsc1 |
| InChI | InChI=1S/C15H17F2N3S/c1-18-15(20-9-11-6-8-21-10-11)19-7-5-12-13(16)3-2-4-14(12)17/h2-4,6,8,10H,5,7,9H2,1H3,(H2,18,19,20) |
| InChIKey | SSMYWMDOBFBNFG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|