C15H18ClN3S — CID 111196680
1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111196680) has the molecular formula C15H18ClN3S and a molecular weight of 307.85 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111196680 |
| Molecular Formula | C15H18ClN3S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCc1ccc(Cl)cc1)NCc1ccsc1 |
| InChI | InChI=1S/C15H18ClN3S/c1-17-15(19-10-13-7-9-20-11-13)18-8-6-12-2-4-14(16)5-3-12/h2-5,7,9,11H,6,8,10H2,1H3,(H2,17,18,19) |
| InChIKey | GQUZKONXGFKXHT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|