C33H52N2O3S — CID 71257043
N-[2-[(2-ethyl-2-octadeca-9,12,15-trienylsulfanylbutanoyl)amino]ethyl]-2-hydroxybenzamide (PubChem CID 71257043) has the molecular formula C33H52N2O3S and a molecular weight of 556.86 g/mol. Its IUPAC name is N-[2-[(2-ethyl-2-octadeca-9,12,15-trienylsulfanylbutanoyl)amino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[(2-ethyl-2-octadeca-9,12,15-trienylsulfanylbutanoyl)amino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71257043 |
| Molecular Formula | C33H52N2O3S |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | N-[2-[(2-ethyl-2-octadeca-9,12,15-trienylsulfanylbutanoyl)amino]ethyl]-2-hydroxybenzamide |
| SMILES | CCC=CCC=CCC=CCCCCCCCCSC(CC)(CC)C(=O)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C33H52N2O3S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-28-39-33(5-2,6-3)32(38)35-27-26-34-31(37)29-24-21-22-25-30(29)36/h7-8,10-11,13-14,21-22,24-25,36H,4-6,9,12,15-20,23,26-28H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | IDKOONQMDNFTJB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|