C33H48O4S — CID 123898404
[2-(dihydroxymethyl)phenyl] 2-ethyl-2-icosa-5,8,11,14,17-pentaenylsulfanylbutanoate (PubChem CID 123898404) has the molecular formula C33H48O4S and a molecular weight of 540.81 g/mol. Its IUPAC name is [2-(dihydroxymethyl)phenyl] 2-ethyl-2-icosa-5,8,11,14,17-pentaenylsulfanylbutanoate.
| Compound Name | [2-(dihydroxymethyl)phenyl] 2-ethyl-2-icosa-5,8,11,14,17-pentaenylsulfanylbutanoate |
|---|---|
| PubChem CID | 123898404 |
| Molecular Formula | C33H48O4S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | [2-(dihydroxymethyl)phenyl] 2-ethyl-2-icosa-5,8,11,14,17-pentaenylsulfanylbutanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCSC(CC)(CC)C(=O)Oc1ccccc1C(O)O |
| InChI | InChI=1S/C33H48O4S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-28-38-33(5-2,6-3)32(36)37-30-27-24-23-26-29(30)31(34)35/h7-8,10-11,13-14,16-17,19-20,23-24,26-27,31,34-35H,4-6,9,12,15,18,21-22,25,28H2,1-3H3 |
| InChIKey | MCUVBWJAEIAQMB-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|