C28H37F3O2 — CID 141277621
1,1,2-trifluoroethyl (9Z,12Z,15Z)-2-(2-ethenylphenyl)octadeca-9,12,15-trienoate (PubChem CID 141277621) has the molecular formula C28H37F3O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1,1,2-trifluoroethyl (9Z,12Z,15Z)-2-(2-ethenylphenyl)octadeca-9,12,15-trienoate.
| Compound Name | 1,1,2-trifluoroethyl (9Z,12Z,15Z)-2-(2-ethenylphenyl)octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 141277621 |
| Molecular Formula | C28H37F3O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 1,1,2-trifluoroethyl (9Z,12Z,15Z)-2-(2-ethenylphenyl)octadeca-9,12,15-trienoate |
| SMILES | C=Cc1ccccc1C(CCCCCC/C=C\C/C=C\C/C=C\CC)C(=O)OC(F)(F)CF |
| InChI | InChI=1S/C28H37F3O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-22-26(27(32)33-28(30,31)23-29)25-21-19-18-20-24(25)4-2/h4-6,8-9,11-12,18-21,26H,2-3,7,10,13-17,22-23H2,1H3/b6-5-,9-8-,12-11- |
| InChIKey | CMCUGCCXZVXZAA-AGRJPVHOSA-N |
| XLogP | 8.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|