C31H50O4S — CID 67935984
tert-butyl (2R,11Z,14Z)-3-hydroxy-2-(2-methylphenyl)sulfinylicosa-11,14-dienoate (PubChem CID 67935984) has the molecular formula C31H50O4S and a molecular weight of 518.80 g/mol. Its IUPAC name is tert-butyl (2R,11Z,14Z)-3-hydroxy-2-(2-methylphenyl)sulfinylicosa-11,14-dienoate.
| Compound Name | tert-butyl (2R,11Z,14Z)-3-hydroxy-2-(2-methylphenyl)sulfinylicosa-11,14-dienoate |
|---|---|
| PubChem CID | 67935984 |
| Molecular Formula | C31H50O4S |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | tert-butyl (2R,11Z,14Z)-3-hydroxy-2-(2-methylphenyl)sulfinylicosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(O)[C@H](C(=O)OC(C)(C)C)S(=O)c1ccccc1C |
| InChI | InChI=1S/C31H50O4S/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27(32)29(30(33)35-31(3,4)5)36(34)28-25-22-21-23-26(28)2/h10-11,13-14,21-23,25,27,29,32H,6-9,12,15-20,24H2,1-5H3/b11-10-,14-13-/t27?,29-,36?/m1/s1 |
| InChIKey | VUGGJYPBLFGDFG-NYCYWENTSA-N |
| XLogP | 7.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|