C26H42O2S — CID 174238484
2-ethyl-2-[(5Z,8Z,14Z,17Z)-icosa-1,5,8,14,17-pentaenyl]sulfanylbutanoic acid (PubChem CID 174238484) has the molecular formula C26H42O2S and a molecular weight of 418.69 g/mol. Its IUPAC name is 2-ethyl-2-[(5Z,8Z,14Z,17Z)-icosa-1,5,8,14,17-pentaenyl]sulfanylbutanoic acid.
| Compound Name | 2-ethyl-2-[(5Z,8Z,14Z,17Z)-icosa-1,5,8,14,17-pentaenyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 174238484 |
| Molecular Formula | C26H42O2S |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 2-ethyl-2-[(5Z,8Z,14Z,17Z)-icosa-1,5,8,14,17-pentaenyl]sulfanylbutanoic acid |
| SMILES | CC/C=C\C/C=C\CCCC/C=C\C/C=C\CCC=CSC(CC)(CC)C(=O)O |
| InChI | InChI=1S/C26H42O2S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29-26(5-2,6-3)25(27)28/h7-8,10-11,16-17,19-20,23-24H,4-6,9,12-15,18,21-22H2,1-3H3,(H,27,28)/b8-7-,11-10-,17-16-,20-19-,24-23? |
| InChIKey | UCJSEHRJQMIOHV-LWNHMJKVSA-N |
| XLogP | 8.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|