C37H53NO4S — CID 71257241
2-[(2-docosa-4,7,10,13,16,19-hexaenylsulfanyl-2-ethylbutanoyl)amino]ethyl 2-hydroxybenzoate (PubChem CID 71257241) has the molecular formula C37H53NO4S and a molecular weight of 607.90 g/mol. Its IUPAC name is 2-[(2-docosa-4,7,10,13,16,19-hexaenylsulfanyl-2-ethylbutanoyl)amino]ethyl 2-hydroxybenzoate.
| Compound Name | 2-[(2-docosa-4,7,10,13,16,19-hexaenylsulfanyl-2-ethylbutanoyl)amino]ethyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 71257241 |
| Molecular Formula | C37H53NO4S |
| Molecular Weight | 607.90 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | 2-[(2-docosa-4,7,10,13,16,19-hexaenylsulfanyl-2-ethylbutanoyl)amino]ethyl 2-hydroxybenzoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCCSC(CC)(CC)C(=O)NCCOC(=O)c1ccccc1O |
| InChI | InChI=1S/C37H53NO4S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-32-43-37(5-2,6-3)36(41)38-30-31-42-35(40)33-28-25-26-29-34(33)39/h7-8,10-11,13-14,16-17,19-20,22-23,25-26,28-29,39H,4-6,9,12,15,18,21,24,27,30-32H2,1-3H3,(H,38,41) |
| InChIKey | FGHFUSACCDUKEZ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.90 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|