C35H49NO4S — CID 53339335
2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenyl]sulfanylbutanoylamino]ethyl 2-hydroxybenzoate (PubChem CID 53339335) has the molecular formula C35H49NO4S and a molecular weight of 579.85 g/mol. Its IUPAC name is 2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenyl]sulfanylbutanoylamino]ethyl 2-hydroxybenzoate.
| Compound Name | 2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenyl]sulfanylbutanoylamino]ethyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 53339335 |
| Molecular Formula | C35H49NO4S |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | 2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenyl]sulfanylbutanoylamino]ethyl 2-hydroxybenzoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCSC(CC)C(=O)NCCOC(=O)c1ccccc1O |
| InChI | InChI=1S/C35H49NO4S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-30-41-33(4-2)34(38)36-28-29-40-35(39)31-26-23-24-27-32(31)37/h5-6,8-9,11-12,14-15,17-18,20-21,23-24,26-27,33,37H,3-4,7,10,13,16,19,22,25,28-30H2,1-2H3,(H,36,38)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | AIHRPMMEWWLDEI-YNUSHXQLSA-N |
| XLogP | 8.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|