C26H36O4 — CID 159571595
2-hydroxy-5-[(10Z,13Z,16Z)-2-oxononadeca-10,13,16-trienyl]benzoic acid (PubChem CID 159571595) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-hydroxy-5-[(10Z,13Z,16Z)-2-oxononadeca-10,13,16-trienyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(10Z,13Z,16Z)-2-oxononadeca-10,13,16-trienyl]benzoic acid |
|---|---|
| PubChem CID | 159571595 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-hydroxy-5-[(10Z,13Z,16Z)-2-oxononadeca-10,13,16-trienyl]benzoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)Cc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)20-22-18-19-25(28)24(21-22)26(29)30/h3-4,6-7,9-10,18-19,21,28H,2,5,8,11-17,20H2,1H3,(H,29,30)/b4-3-,7-6-,10-9- |
| InChIKey | BRCJGEODXHICIA-PDBXOOCHSA-N |
| XLogP | 6.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|