C39H54N2O7S — CID 67092696
[3-[(2-hydroxybenzoyl)amino]-4-methoxy-4-oxobutan-2-yl] 2-[(2-icosa-2,5,8,11,14,17-hexaenylsulfanylacetyl)amino]-3-methylbutanoate (PubChem CID 67092696) has the molecular formula C39H54N2O7S and a molecular weight of 694.94 g/mol. Its IUPAC name is [3-[(2-hydroxybenzoyl)amino]-4-methoxy-4-oxobutan-2-yl] 2-[(2-icosa-2,5,8,11,14,17-hexaenylsulfanylacetyl)amino]-3-methylbutanoate.
| Compound Name | [3-[(2-hydroxybenzoyl)amino]-4-methoxy-4-oxobutan-2-yl] 2-[(2-icosa-2,5,8,11,14,17-hexaenylsulfanylacetyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 67092696 |
| Molecular Formula | C39H54N2O7S |
| Molecular Weight | 694.94 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | [3-[(2-hydroxybenzoyl)amino]-4-methoxy-4-oxobutan-2-yl] 2-[(2-icosa-2,5,8,11,14,17-hexaenylsulfanylacetyl)amino]-3-methylbutanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCSCC(=O)NC(C(=O)OC(C)C(NC(=O)c1ccccc1O)C(=O)OC)C(C)C |
| InChI | InChI=1S/C39H54N2O7S/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-28-49-29-34(43)40-35(30(2)3)39(46)48-31(4)36(38(45)47-5)41-37(44)32-26-23-24-27-33(32)42/h7-8,10-11,13-14,16-17,19-20,22-27,30-31,35-36,42H,6,9,12,15,18,21,28-29H2,1-5H3,(H,40,43)(H,41,44) |
| InChIKey | DBIUJHUPBYKLJF-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.94 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|