C33H46N6O5 — CID 137025607
2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl]carbamic acid (PubChem CID 137025607) has the molecular formula C33H46N6O5 and a molecular weight of 606.77 g/mol. Its IUPAC name is 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl]carbamic acid.
| Compound Name | 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 137025607 |
| Molecular Formula | C33H46N6O5 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl]carbamic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCN(C[C@@H]1CC[C@H](n2cnc3c(=O)[nH]cnc32)O1)C(=O)O |
| InChI | InChI=1S/C33H46N6O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-28(40)34-22-23-38(33(42)43)24-27-20-21-29(44-27)39-26-37-30-31(39)35-25-36-32(30)41/h3-4,6-7,9-10,12-13,15-16,25-27,29H,2,5,8,11,14,17-24H2,1H3,(H,34,40)(H,42,43)(H,35,36,41)/b4-3-,7-6-,10-9-,13-12-,16-15-/t27-,29+/m0/s1 |
| InChIKey | ICMVMJDVWVAJQJ-XAXGXEQNSA-N |
| XLogP | 5.82 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|