C40H64N8O11 — CID 135501267
tritert-butyl 11-[5-oxo-5-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]pentanoyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate (PubChem CID 135501267) has the molecular formula C40H64N8O11 and a molecular weight of 833.00 g/mol. Its IUPAC name is tritert-butyl 11-[5-oxo-5-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]pentanoyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate.
| Compound Name | tritert-butyl 11-[5-oxo-5-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]pentanoyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
|---|---|
| PubChem CID | 135501267 |
| Molecular Formula | C40H64N8O11 |
| Molecular Weight | 833.00 g/mol |
| Exact Mass | 832.47 |
| IUPAC Name | tritert-butyl 11-[5-oxo-5-[[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]pentanoyl]-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCCN(C(=O)CCCC(=O)OC[C@@H]2CC[C@H](n3cnc4c(=O)[nH]cnc43)O2)CC1 |
| InChI | InChI=1S/C40H64N8O11/c1-38(2,3)57-35(52)45-19-12-20-47(37(54)59-40(7,8)9)24-23-46(36(53)58-39(4,5)6)18-11-17-44(21-22-45)29(49)13-10-14-31(50)55-25-28-15-16-30(56-28)48-27-43-32-33(48)41-26-42-34(32)51/h26-28,30H,10-25H2,1-9H3,(H,41,42,51)/t28-,30+/m0/s1 |
| InChIKey | FDUNQQBBHPWTPF-MFMCTBQISA-N |
| XLogP | 4.84 |
| TPSA | 208.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.00 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|