C24H27N7O9S — CID 135465431
[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxycarbonylamino]ethylsulfanylformate (PubChem CID 135465431) has the molecular formula C24H27N7O9S and a molecular weight of 589.59 g/mol. Its IUPAC name is [(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxycarbonylamino]ethylsulfanylformate.
| Compound Name | [(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxycarbonylamino]ethylsulfanylformate |
|---|---|
| PubChem CID | 135465431 |
| Molecular Formula | C24H27N7O9S |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxycarbonylamino]ethylsulfanylformate |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COC(=O)NCCSC(=O)OC[C@@H]3CC[C@H](n4cnc5c(=O)[nH]cnc54)O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H27N7O9S/c1-13-8-30(22(34)29-20(13)32)16-4-2-14(39-16)9-37-23(35)25-6-7-41-24(36)38-10-15-3-5-17(40-15)31-12-28-18-19(31)26-11-27-21(18)33/h2,4,8,11-12,14-17H,3,5-7,9-10H2,1H3,(H,25,35)(H,26,27,33)(H,29,32,34)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | JEPODXHZYOVQNA-MWDXBVQZSA-N |
| XLogP | 0.71 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|