C19H20ClN3O5 — CID 502183
[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl N-[2-(4-chlorophenyl)ethyl]carbamate (PubChem CID 502183) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl N-[2-(4-chlorophenyl)ethyl]carbamate.
| Compound Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl N-[2-(4-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 502183 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl N-[2-(4-chlorophenyl)ethyl]carbamate |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COC(=O)NCCc3ccc(Cl)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H20ClN3O5/c1-12-10-23(18(25)22-17(12)24)16-7-6-15(28-16)11-27-19(26)21-9-8-13-2-4-14(20)5-3-13/h2-7,10,15-16H,8-9,11H2,1H3,(H,21,26)(H,22,24,25)/t15-,16+/m0/s1 |
| InChIKey | MSTCJQMAKQXEQJ-JKSUJKDBSA-N |
| XLogP | 1.92 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|