C14H21N6O5P — CID 154927053
[(2S,5R)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxyphosphonamidous acid (PubChem CID 154927053) has the molecular formula C14H21N6O5P and a molecular weight of 384.33 g/mol. Its IUPAC name is [(2S,5R)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxyphosphonamidous acid.
| Compound Name | [(2S,5R)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxyphosphonamidous acid |
|---|---|
| PubChem CID | 154927053 |
| Molecular Formula | C14H21N6O5P |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(2S,5R)-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxyphosphonamidous acid |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@H]2CC[C@@H](COP(N)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H21N6O5P/c1-7(2)12(21)18-14-17-11-10(13(22)19-14)16-6-20(11)9-4-3-8(25-9)5-24-26(15)23/h6-9,23H,3-5,15H2,1-2H3,(H2,17,18,19,21,22)/t8-,9+,26?/m0/s1 |
| InChIKey | HBOIJEVIOBWIKN-NZTGGNNDSA-N |
| XLogP | 0.59 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|