C19H27N4O10P — CID 146031052
[(2S,5R)-5-[4-[[4-[4-(methylamino)butanoyloxymethoxy]-4-oxobutanoyl]amino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxido-oxophosphanium (PubChem CID 146031052) has the molecular formula C19H27N4O10P and a molecular weight of 502.42 g/mol. Its IUPAC name is [(2S,5R)-5-[4-[[4-[4-(methylamino)butanoyloxymethoxy]-4-oxobutanoyl]amino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxido-oxophosphanium.
| Compound Name | [(2S,5R)-5-[4-[[4-[4-(methylamino)butanoyloxymethoxy]-4-oxobutanoyl]amino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 146031052 |
| Molecular Formula | C19H27N4O10P |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [(2S,5R)-5-[4-[[4-[4-(methylamino)butanoyloxymethoxy]-4-oxobutanoyl]amino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxido-oxophosphanium |
| SMILES | CNCCCC(=O)OCOC(=O)CCC(=O)Nc1ccn([C@H]2CC[C@@H](CO[P+](=O)[O-])O2)c(=O)n1 |
| InChI | InChI=1S/C19H27N4O10P/c1-20-9-2-3-17(25)30-12-31-18(26)7-5-15(24)21-14-8-10-23(19(27)22-14)16-6-4-13(33-16)11-32-34(28)29/h8,10,13,16,20H,2-7,9,11-12H2,1H3,(H,21,22,24,27)/t13-,16+/m0/s1 |
| InChIKey | UVMFEDMWIUEPNE-XJKSGUPXSA-N |
| XLogP | -0.28 |
| TPSA | 187.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|