C12H20N4O4 — CID 156825342
4-amino-1-[(2R)-5-[(2-amino-1-hydroxyethoxy)methyl]-5-methyloxolan-2-yl]pyrimidin-2-one (PubChem CID 156825342) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-amino-1-[(2R)-5-[(2-amino-1-hydroxyethoxy)methyl]-5-methyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R)-5-[(2-amino-1-hydroxyethoxy)methyl]-5-methyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 156825342 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-amino-1-[(2R)-5-[(2-amino-1-hydroxyethoxy)methyl]-5-methyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CC1(COC(O)CN)CC[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C12H20N4O4/c1-12(7-19-10(17)6-13)4-2-9(20-12)16-5-3-8(14)15-11(16)18/h3,5,9-10,17H,2,4,6-7,13H2,1H3,(H2,14,15,18)/t9-,10?,12?/m1/s1 |
| InChIKey | MPKMAKWDBRZQCQ-GRZMOONWSA-N |
| XLogP | -0.81 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|