C17H19F2N3O3 — CID 144900272
4-amino-1-[5-(difluoromethyl)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 144900272) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is 4-amino-1-[5-(difluoromethyl)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-(difluoromethyl)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 144900272 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 4-amino-1-[5-(difluoromethyl)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2CCC(COCc3ccccc3)(C(F)F)O2)c(=O)n1 |
| InChI | InChI=1S/C17H19F2N3O3/c18-15(19)17(11-24-10-12-4-2-1-3-5-12)8-6-14(25-17)22-9-7-13(20)21-16(22)23/h1-5,7,9,14-15H,6,8,10-11H2,(H2,20,21,23) |
| InChIKey | CSIFWDZQTLRNGO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |