C20H24FN4O13P3 — CID 134168005
[[(2R,3R,4R,5S)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 134168005) has the molecular formula C20H24FN4O13P3 and a molecular weight of 640.35 g/mol. Its IUPAC name is [[(2R,3R,4R,5S)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5S)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 134168005 |
| Molecular Formula | C20H24FN4O13P3 |
| Molecular Weight | 640.35 g/mol |
| Exact Mass | 640.05 |
| IUPAC Name | [[(2R,3R,4R,5S)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](c2ccc3c(NC(=O)c4ccccc4)ncnn23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C20H24FN4O13P3/c1-2-20(10-35-40(31,32)38-41(33,34)37-39(28,29)30)17(26)15(21)16(36-20)13-8-9-14-18(22-11-23-25(13)14)24-19(27)12-6-4-3-5-7-12/h3-9,11,15-17,26H,2,10H2,1H3,(H,31,32)(H,33,34)(H2,28,29,30)(H,22,23,24,27)/t15-,16-,17-,20+/m0/s1 |
| InChIKey | KJKLZKXUYZJQEB-OGNFBWPZSA-N |
| XLogP | 2.24 |
| TPSA | 248.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|