C24H36N4O6 — CID 169174562
[(2R,3S,4R,5S)-5-[4-(2-ethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-2-methyloxolan-2-yl]methyl 2-ethylbutanoate (PubChem CID 169174562) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-[4-(2-ethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-2-methyloxolan-2-yl]methyl 2-ethylbutanoate.
| Compound Name | [(2R,3S,4R,5S)-5-[4-(2-ethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-2-methyloxolan-2-yl]methyl 2-ethylbutanoate |
|---|---|
| PubChem CID | 169174562 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | [(2R,3S,4R,5S)-5-[4-(2-ethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-2-methyloxolan-2-yl]methyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)Nc1ncnn2c([C@@H]3O[C@](C)(COC(=O)C(CC)CC)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C24H36N4O6/c1-6-14(7-2)22(31)27-21-17-11-10-16(28(17)26-13-25-21)19-18(29)20(30)24(5,34-19)12-33-23(32)15(8-3)9-4/h10-11,13-15,18-20,29-30H,6-9,12H2,1-5H3,(H,25,26,27,31)/t18-,19-,20-,24+/m0/s1 |
| InChIKey | HHHPIABWFFVSOG-AZXNSQLWSA-N |
| XLogP | 2.64 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |