C19H33N5O6 — CID 169174977
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl tert-butyl carbonate;azane;ethane (PubChem CID 169174977) has the molecular formula C19H33N5O6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl tert-butyl carbonate;azane;ethane.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl tert-butyl carbonate;azane;ethane |
|---|---|
| PubChem CID | 169174977 |
| Molecular Formula | C19H33N5O6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl tert-butyl carbonate;azane;ethane |
| SMILES | CC.CC(C)(C)OC(=O)OC[C@@]1(C)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O.N |
| InChI | InChI=1S/C17H24N4O6.C2H6.H3N/c1-16(2,3)27-15(24)25-7-17(4)13(23)11(22)12(26-17)9-5-6-10-14(18)19-8-20-21(9)10;1-2;/h5-6,8,11-13,22-23H,7H2,1-4H3,(H2,18,19,20);1-2H3;1H3/t11-,12-,13-,17+;;/m0../s1 |
| InChIKey | NMDCTFOILLKMER-MRZZEKIYSA-N |
| XLogP | 2.00 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |