C12H14N6O4 — CID 118068928
(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 118068928) has the molecular formula C12H14N6O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 118068928 |
| Molecular Formula | C12H14N6O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](c2ccc3c(N)ccnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14N6O4/c13-6-3-4-15-18-7(6)1-2-8(18)10-9(20)11(21)12(5-19,22-10)16-17-14/h1-4,9-11,19-21H,5,13H2/t9-,10-,11-,12+/m0/s1 |
| InChIKey | BQOLZUHIWZXKLR-FIQHERPVSA-N |
| XLogP | -0.29 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|