C13H16ClN3O4 — CID 118068934
(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 118068934) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 118068934 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ccnn2c([C@@H]3O[C@@](CO)(CCl)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C13H16ClN3O4/c14-5-13(6-18)12(20)10(19)11(21-13)9-2-1-8-7(15)3-4-16-17(8)9/h1-4,10-12,18-20H,5-6,15H2/t10-,11-,12-,13+/m0/s1 |
| InChIKey | OVVSLHCTOWPIFD-ZDEQEGDKSA-N |
| XLogP | -0.32 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|