C10H16ClN3O5 — CID 123232279
5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 123232279) has the molecular formula C10H16ClN3O5 and a molecular weight of 293.71 g/mol. Its IUPAC name is 5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 123232279 |
| Molecular Formula | C10H16ClN3O5 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NC1=NC(O)N(C2OC(CO)(CCl)C(O)C2O)C=C1 |
| InChI | InChI=1S/C10H16ClN3O5/c11-3-10(4-15)7(17)6(16)8(19-10)14-2-1-5(12)13-9(14)18/h1-2,6-9,15-18H,3-4H2,(H2,12,13) |
| InChIKey | BXJNFTWXLLRNKE-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|