C18H29ClFN3O5 — CID 134366100
[(2R,3R,4R,5R)-5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl octanoate (PubChem CID 134366100) has the molecular formula C18H29ClFN3O5 and a molecular weight of 421.90 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl octanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 134366100 |
| Molecular Formula | C18H29ClFN3O5 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-hydroxy-2H-pyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@@]1(CCl)O[C@@H](N2C=CC(N)=NC2O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C18H29ClFN3O5/c1-2-3-4-5-6-7-13(24)27-11-18(10-19)15(25)14(20)16(28-18)23-9-8-12(21)22-17(23)26/h8-9,14-17,25-26H,2-7,10-11H2,1H3,(H2,21,22)/t14-,15+,16-,17?,18-/m1/s1 |
| InChIKey | KHVWGUGRZMRFIZ-YUGHNKOSSA-N |
| XLogP | 1.39 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|