C22H34FN5O6 — CID 174355168
2,2-dimethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]propanoate (PubChem CID 174355168) has the molecular formula C22H34FN5O6 and a molecular weight of 483.54 g/mol. Its IUPAC name is 2,2-dimethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]propanoate.
| Compound Name | 2,2-dimethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]propanoate |
|---|---|
| PubChem CID | 174355168 |
| Molecular Formula | C22H34FN5O6 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2,2-dimethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]propanoate |
| SMILES | CCC(C)(C)COC(=O)[C@H](C)NCOC[C@@]1(CF)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H34FN5O6/c1-5-21(3,4)9-33-20(31)13(2)26-12-32-10-22(8-23)18(30)16(29)17(34-22)14-6-7-15-19(24)25-11-27-28(14)15/h6-7,11,13,16-18,26,29-30H,5,8-10,12H2,1-4H3,(H2,24,25,27)/t13-,16-,17-,18-,22+/m0/s1 |
| InChIKey | LDFLYAKFXUDUSE-CQWTVFJJSA-N |
| XLogP | 0.74 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|