C18H20N4O4P+ — CID 123993282
[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 123993282) has the molecular formula C18H20N4O4P+ and a molecular weight of 387.36 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 123993282 |
| Molecular Formula | C18H20N4O4P+ |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | CC1(CO[P+](=O)Oc2ccccc2)CCC(c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C18H20N4O4P/c1-18(11-24-27(23)26-13-5-3-2-4-6-13)10-9-16(25-18)14-7-8-15-17(19)20-12-21-22(14)15/h2-8,12,16H,9-11H2,1H3,(H2,19,20,21)/q+1 |
| InChIKey | YBVUZAFNXZUIQA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|