C26H31FN4O8P+ — CID 166753813
[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 166753813) has the molecular formula C26H31FN4O8P+ and a molecular weight of 577.53 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 166753813 |
| Molecular Formula | C26H31FN4O8P+ |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | [(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](c2ccc3c(N)ncnn23)O[C@](CF)(CO[P+](=O)Oc2ccccc2)[C@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C26H31FN4O8P/c1-15(2)24(32)36-21-20(18-10-11-19-23(28)29-14-30-31(18)19)38-26(12-27,22(21)37-25(33)16(3)4)13-35-40(34)39-17-8-6-5-7-9-17/h5-11,14-16,20-22H,12-13H2,1-4H3,(H2,28,29,30)/q+1/t20-,21-,22-,26+/m0/s1 |
| InChIKey | GMHPMDKEJKLCDL-OYSWMMLKSA-N |
| XLogP | 3.98 |
| TPSA | 153.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|