C27H36N5O9P — CID 137277836
cyclohexyl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 137277836) has the molecular formula C27H36N5O9P and a molecular weight of 605.59 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137277836 |
| Molecular Formula | C27H36N5O9P |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | cyclohexyl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(NC(C)C(=O)OC3CCCCC3)Oc3ccccc3)[C@@H](O)[C@@]2(C)O)c(=O)[nH]1 |
| InChI | InChI=1S/C27H36N5O9P/c1-16(25(35)39-18-10-6-4-7-11-18)31-42(37,41-19-12-8-5-9-13-19)38-14-20-22(33)27(3,36)26(40-20)32-15-28-21-23(32)29-17(2)30-24(21)34/h5,8-9,12-13,15-16,18,20,22,26,33,36H,4,6-7,10-11,14H2,1-3H3,(H,31,37)(H,29,30,34)/t16?,20-,22-,26-,27-,42?/m1/s1 |
| InChIKey | ICJHEEWDRJJOBM-GPGVRXEPSA-N |
| XLogP | 2.50 |
| TPSA | 187.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|