C25H30N3O10P — CID 129067727
cyclobutyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 129067727) has the molecular formula C25H30N3O10P and a molecular weight of 563.50 g/mol. Its IUPAC name is cyclobutyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129067727 |
| Molecular Formula | C25H30N3O10P |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | cyclobutyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OC2CCC2)Oc2ccccc2)O[C@@]1(C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C25H30N3O10P/c1-4-25(33)21(30)19(37-24(25,3)28-14-13-20(29)26-23(28)32)15-35-39(34,38-18-9-6-5-7-10-18)27-16(2)22(31)36-17-11-8-12-17/h1,5-7,9-10,13-14,16-17,19,21,30,33H,8,11-12,15H2,2-3H3,(H,27,34)(H,26,29,32)/t16-,19+,21+,24+,25+,39?/m0/s1 |
| InChIKey | UBAZXWZWULHBHC-QUWHQNSRSA-N |
| XLogP | 0.61 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|