C31H37N6O8P — CID 66779155
CID 66779155 (PubChem CID 66779155) has the molecular formula C31H37N6O8P and a molecular weight of 652.65 g/mol.
| Compound Name | CID 66779155 |
|---|---|
| PubChem CID | 66779155 |
| Molecular Formula | C31H37N6O8P |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | — |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COc2ccc3ccccc3c2O/[P+]([O-])=N\[C@@H](C)C(=O)OC2CCCCC2)C[C@@]1(C)O |
| InChI | InChI=1S/C31H37N6O8P/c1-18(28(38)43-20-10-5-4-6-11-20)36-46(40)45-25-22-12-8-7-9-19(22)13-14-23(25)42-16-21-15-31(2,39)29(44-21)37-17-33-24-26(37)34-30(32)35-27(24)41-3/h7-9,12-14,17-18,20-21,29,39H,4-6,10-11,15-16H2,1-3H3,(H2,32,34,35)/t18-,21-,29?,31+/m0/s1 |
| InChIKey | XVXHRJBSQVPORV-VNEJRDCRSA-N |
| XLogP | 4.19 |
| TPSA | 188.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|