C25H27N6O8P — CID 66779175
CID 66779175 (PubChem CID 66779175) has the molecular formula C25H27N6O8P and a molecular weight of 570.50 g/mol.
| Compound Name | CID 66779175 |
|---|---|
| PubChem CID | 66779175 |
| Molecular Formula | C25H27N6O8P |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | — |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COc2ccc3ccccc3c2O/[P+]([O-])=N\C(C)C(=O)O)C[C@@]1(C)O |
| InChI | InChI=1S/C25H27N6O8P/c1-13(22(32)33)30-40(35)39-19-16-7-5-4-6-14(16)8-9-17(19)37-11-15-10-25(2,34)23(38-15)31-12-27-18-20(31)28-24(26)29-21(18)36-3/h4-9,12-13,15,23,34H,10-11H2,1-3H3,(H,32,33)(H2,26,28,29)/t13?,15-,23?,25+/m0/s1 |
| InChIKey | YIKSSDGTXBFDJG-LCPQMHQQSA-N |
| XLogP | 2.40 |
| TPSA | 199.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|