C29H32IN6O9P — CID 90149796
CID 90149796 (PubChem CID 90149796) has the molecular formula C29H32IN6O9P and a molecular weight of 766.49 g/mol.
| Compound Name | CID 90149796 |
|---|---|
| PubChem CID | 90149796 |
| Molecular Formula | C29H32IN6O9P |
| Molecular Weight | 766.49 g/mol |
| Exact Mass | 766.10 |
| IUPAC Name | — |
| SMILES | COc1nc(N)nc2c1nc(I)n2[C@@H]1O[C@H](COc2ccc3ccccc3c2O/[P+]([O-])=N\[C@@H](C)C(=O)OC2CCC2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C29H32IN6O9P/c1-14(25(38)43-16-8-6-9-16)35-46(40)45-21-17-10-5-4-7-15(17)11-12-18(21)42-13-19-22(37)29(2,39)26(44-19)36-23-20(32-27(36)30)24(41-3)34-28(31)33-23/h4-5,7,10-12,14,16,19,22,26,37,39H,6,8-9,13H2,1-3H3,(H2,31,33,34)/t14-,19+,22+,26+,29+/m0/s1 |
| InChIKey | FWHZPSNZBXOMHB-QUEGZXHWSA-N |
| XLogP | 2.98 |
| TPSA | 208.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|