C18H19F2N4O8P — CID 118672221
CID 118672221 (PubChem CID 118672221) has the molecular formula C18H19F2N4O8P and a molecular weight of 488.34 g/mol.
| Compound Name | CID 118672221 |
|---|---|
| PubChem CID | 118672221 |
| Molecular Formula | C18H19F2N4O8P |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | — |
| SMILES | C[C@H](/N=[P+](\[O-])Oc1ccccc1OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(F)(F)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C18H19F2N4O8P/c1-9(15(26)27)23-33(29)32-11-5-3-2-4-10(11)30-8-12-14(25)18(19,20)16(31-12)24-7-6-13(21)22-17(24)28/h2-7,9,12,14,16,25H,8H2,1H3,(H,26,27)(H2,21,22,28)/t9-,12+,14-,16+/m0/s1 |
| InChIKey | YEJURYJTOPUVTK-UODBANLJSA-N |
| XLogP | 0.51 |
| TPSA | 181.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|