C28H36F2N5O11P — CID 118672165
CID 118672165 (PubChem CID 118672165) has the molecular formula C28H36F2N5O11P and a molecular weight of 687.59 g/mol.
| Compound Name | CID 118672165 |
|---|---|
| PubChem CID | 118672165 |
| Molecular Formula | C28H36F2N5O11P |
| Molecular Weight | 687.59 g/mol |
| Exact Mass | 687.21 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccn([C@@H]2O[C@H](COc3ccccc3O/[P+]([O-])=N/[C@@H](C)C(=O)O)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C28H36F2N5O11P/c1-14(2)20(33-26(41)45-27(4,5)6)22(37)31-19-11-12-35(25(40)32-19)24-28(29,30)21(36)18(44-24)13-43-16-9-7-8-10-17(16)46-47(42)34-15(3)23(38)39/h7-12,14-15,18,20-21,24,36H,13H2,1-6H3,(H,33,41)(H,38,39)(H,31,32,37,40)/t15-,18+,20+,21+,24+/m0/s1 |
| InChIKey | ZIPJUQILTCYQEX-VRXPMYQQSA-N |
| XLogP | 2.41 |
| TPSA | 222.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|