C24H28F2N5O9P — CID 118672161
CID 118672161 (PubChem CID 118672161) has the molecular formula C24H28F2N5O9P and a molecular weight of 599.48 g/mol.
| Compound Name | CID 118672161 |
|---|---|
| PubChem CID | 118672161 |
| Molecular Formula | C24H28F2N5O9P |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | — |
| SMILES | C[C@H](/N=[P+](\[O-])Oc1ccccc1OC[C@H]1O[C@@H](n2ccc(NC(=O)[C@H]3CCN(C)C3)nc2=O)C(F)(F)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C24H28F2N5O9P/c1-13(21(34)35)29-41(37)40-16-6-4-3-5-15(16)38-12-17-19(32)24(25,26)22(39-17)31-10-8-18(28-23(31)36)27-20(33)14-7-9-30(2)11-14/h3-6,8,10,13-14,17,19,22,32H,7,9,11-12H2,1-2H3,(H,34,35)(H,27,28,33,36)/t13-,14-,17+,19+,22+/m0/s1 |
| InChIKey | CSCXISDDFGCPJC-RJKYRHMYSA-N |
| XLogP | 0.81 |
| TPSA | 187.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|