C19H19Cl2FN3O9P — CID 151177374
[(1S)-1-carboxyethyl]imino-[3,4-dichloro-2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phenoxy]-oxidophosphanium (PubChem CID 151177374) has the molecular formula C19H19Cl2FN3O9P and a molecular weight of 554.25 g/mol. Its IUPAC name is [(1S)-1-carboxyethyl]imino-[3,4-dichloro-2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phenoxy]-oxidophosphanium.
| Compound Name | [(1S)-1-carboxyethyl]imino-[3,4-dichloro-2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phenoxy]-oxidophosphanium |
|---|---|
| PubChem CID | 151177374 |
| Molecular Formula | C19H19Cl2FN3O9P |
| Molecular Weight | 554.25 g/mol |
| Exact Mass | 553.02 |
| IUPAC Name | [(1S)-1-carboxyethyl]imino-[3,4-dichloro-2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phenoxy]-oxidophosphanium |
| SMILES | C[C@H](/N=[P+](\[O-])Oc1ccc(Cl)c(Cl)c1OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C19H19Cl2FN3O9P/c1-8(16(28)29)24-35(31)34-10-4-3-9(20)13(21)14(10)32-7-11-15(27)19(2,22)17(33-11)25-6-5-12(26)23-18(25)30/h3-6,8,11,15,17,27H,7H2,1-2H3,(H,28,29)(H,23,26,30)/t8-,11+,15+,17+,19+/m0/s1 |
| InChIKey | NDNZJZDUEFBTNI-QYRNYSQTSA-N |
| XLogP | 1.62 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|