C21H24Cl2FN3O9P+ — CID 87401656
(2,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-ethoxy-1-oxopropan-2-yl)amino]-oxophosphanium (PubChem CID 87401656) has the molecular formula C21H24Cl2FN3O9P+ and a molecular weight of 583.31 g/mol. Its IUPAC name is (2,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-ethoxy-1-oxopropan-2-yl)amino]-oxophosphanium.
| Compound Name | (2,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-ethoxy-1-oxopropan-2-yl)amino]-oxophosphanium |
|---|---|
| PubChem CID | 87401656 |
| Molecular Formula | C21H24Cl2FN3O9P+ |
| Molecular Weight | 583.31 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | (2,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-ethoxy-1-oxopropan-2-yl)amino]-oxophosphanium |
| SMILES | CCOC(=O)C(C)N(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)[P+](=O)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H23Cl2FN3O9P/c1-4-33-18(30)11(2)27(37(32)36-14-6-5-12(22)9-13(14)23)34-10-15-17(29)21(3,24)19(35-15)26-8-7-16(28)25-20(26)31/h5-9,11,15,17,19,29H,4,10H2,1-3H3/p+1/t11?,15-,17-,19-,21-/m1/s1 |
| InChIKey | NIIZVSCJVSQWHI-SGPNRKTOSA-O |
| XLogP | 2.75 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|