C23H29FN3O9P — CID 134275452
propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]but-3-enoate (PubChem CID 134275452) has the molecular formula C23H29FN3O9P and a molecular weight of 541.47 g/mol. Its IUPAC name is propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]but-3-enoate.
| Compound Name | propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]but-3-enoate |
|---|---|
| PubChem CID | 134275452 |
| Molecular Formula | C23H29FN3O9P |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]but-3-enoate |
| SMILES | C=C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1)C(=O)OCCC |
| InChI | InChI=1S/C23H29FN3O9P/c1-4-13-33-20(30)16(5-2)26-37(32,36-15-9-7-6-8-10-15)34-14-17-19(29)23(3,24)21(35-17)27-12-11-18(28)25-22(27)31/h5-12,16-17,19,21,29H,2,4,13-14H2,1,3H3,(H,26,32)(H,25,28,31)/t16-,17+,19+,21+,23+,37?/m0/s1 |
| InChIKey | FNFHJMDZBQFMFL-YGKLTKILSA-N |
| XLogP | 1.82 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|