C22H26F2N5O9P — CID 118672188
CID 118672188 (PubChem CID 118672188) has the molecular formula C22H26F2N5O9P and a molecular weight of 573.45 g/mol.
| Compound Name | CID 118672188 |
|---|---|
| PubChem CID | 118672188 |
| Molecular Formula | C22H26F2N5O9P |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | — |
| SMILES | CC(/N=[P+](\[O-])Oc1ccccc1OC[C@H]1O[C@@H](n2ccc(NC(=O)CN(C)C)nc2=O)C(F)(F)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C22H26F2N5O9P/c1-12(19(32)33)27-39(35)38-14-7-5-4-6-13(14)36-11-15-18(31)22(23,24)20(37-15)29-9-8-16(26-21(29)34)25-17(30)10-28(2)3/h4-9,12,15,18,20,31H,10-11H2,1-3H3,(H,32,33)(H,25,26,30,34)/t12?,15-,18-,20-/m1/s1 |
| InChIKey | TXRMCLFUQUWGFT-JYOPTZLGSA-N |
| XLogP | 0.42 |
| TPSA | 187.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|